EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18F3N3O2 |
| Net Charge | 0 |
| Average Mass | 401.388 |
| Monoisotopic Mass | 401.13511 |
| SMILES | O=C(c1cc(O)nc2ccccc12)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H18F3N3O2/c22-21(23,24)14-4-3-5-15(12-14)26-8-10-27(11-9-26)20(29)17-13-19(28)25-18-7-2-1-6-16(17)18/h1-7,12-13H,8-11H2,(H,25,28) |
| InChIKey | NKHDYQSOEVSMNT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[4-[3-(Trifluoromethyl)phenyl]piperazine-1-carbonyl]-1H-quinolin-2-one (CHEBI:149821) has role anticoronaviral agent (CHEBI:149553) |
| 4-[4-[3-(Trifluoromethyl)phenyl]piperazine-1-carbonyl]-1H-quinolin-2-one (CHEBI:149821) is a quinolines (CHEBI:26513) |