EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14ClN3O2 |
| Net Charge | 0 |
| Average Mass | 303.749 |
| Monoisotopic Mass | 303.07745 |
| SMILES | O=C(Nc1ccccc1)NN(C(=O)CCl)c1ccccc1 |
| InChI | InChI=1S/C15H14ClN3O2/c16-11-14(20)19(13-9-5-2-6-10-13)18-15(21)17-12-7-3-1-4-8-12/h1-10H,11H2,(H2,17,18,21) |
| InChIKey | MBYYZKVXOFINJG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(Chloroacetyl)-N,2-diphenylhydrazinecarboxamide (CHEBI:149818) has role anticoronaviral agent (CHEBI:149553) |
| 2-(Chloroacetyl)-N,2-diphenylhydrazinecarboxamide (CHEBI:149818) is a ureas (CHEBI:47857) |