EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H12FN3O3 |
| Net Charge | 0 |
| Average Mass | 349.321 |
| Monoisotopic Mass | 349.08627 |
| SMILES | O=C1NC(=O)N(c2ccccc2F)C(=O)/C1=C/c1cnc2ccccc12 |
| InChI | InChI=1S/C19H12FN3O3/c20-14-6-2-4-8-16(14)23-18(25)13(17(24)22-19(23)26)9-11-10-21-15-7-3-1-5-12(11)15/h1-10,21H,(H,22,24,26)/b13-9+ |
| InChIKey | BTXWOQBYISISBP-UKTHLTGXSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CHEMBL1465537 (CHEBI:149816) has role anticoronaviral agent (CHEBI:149553) |
| CHEMBL1465537 (CHEBI:149816) is a indoles (CHEBI:24828) |