EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10BrN3O |
| Net Charge | 0 |
| Average Mass | 316.158 |
| Monoisotopic Mass | 315.00072 |
| SMILES | O=C(Cn1nnc2ccccc21)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H10BrN3O/c15-11-7-5-10(6-8-11)14(19)9-18-13-4-2-1-3-12(13)16-17-18/h1-8H,9H2 |
| InChIKey | VGUSWIHOGHPDPF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(Benzotriazol-1-yl)-1-(4-bromophenyl)ethanone (CHEBI:149815) has role anticoronaviral agent (CHEBI:149553) |
| 2-(Benzotriazol-1-yl)-1-(4-bromophenyl)ethanone (CHEBI:149815) is a aromatic ketone (CHEBI:76224) |