EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7N5O4S |
| Net Charge | 0 |
| Average Mass | 281.253 |
| Monoisotopic Mass | 281.02187 |
| SMILES | O=C(CSc1ccccn1)Nc1nonc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7N5O4S/c15-6(5-19-7-3-1-2-4-10-7)11-8-9(14(16)17)13-18-12-8/h1-4H,5H2,(H,11,12,15) |
| InChIKey | CMBQZZZKKJLRIR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(4-Nitro-1,2,5-oxadiazol-3-yl)-2-pyridin-2-ylsulfanylacetamide (CHEBI:149814) has role anticoronaviral agent (CHEBI:149553) |
| N-(4-Nitro-1,2,5-oxadiazol-3-yl)-2-pyridin-2-ylsulfanylacetamide (CHEBI:149814) is a aromatic amide (CHEBI:62733) |