EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H15BrO5 |
| Net Charge | 0 |
| Average Mass | 427.250 |
| Monoisotopic Mass | 426.01029 |
| SMILES | COc1ccccc1/C=C/C(=O)c1cc(Br)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C21H15BrO5/c1-25-18-6-3-2-5-14(18)8-10-17(23)16-13-15(22)9-11-19(16)27-21(24)20-7-4-12-26-20/h2-13H,1H3/b10-8+ |
| InChIKey | VWINSIBMLLVGIS-CSKARUKUSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Bromo-2-[3-(2-methoxyphenyl)acryloyl]phenyl 2-furoate (CHEBI:149813) has role anticoronaviral agent (CHEBI:149553) |
| 4-Bromo-2-[3-(2-methoxyphenyl)acryloyl]phenyl 2-furoate (CHEBI:149813) is a aromatic compound (CHEBI:33655) |