EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N2O4 |
| Net Charge | 0 |
| Average Mass | 338.363 |
| Monoisotopic Mass | 338.12666 |
| SMILES | COc1ccccc1OCCNC(=O)c1cc(O)nc2ccccc12 |
| InChI | InChI=1S/C19H18N2O4/c1-24-16-8-4-5-9-17(16)25-11-10-20-19(23)14-12-18(22)21-15-7-3-2-6-13(14)15/h2-9,12H,10-11H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | IOKPKVSTRDCKNE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-(2-Methoxyphenoxy)ethyl]-2-oxo-1H-quinoline-4-carboxamide (CHEBI:149811) has role anticoronaviral agent (CHEBI:149553) |
| N-[2-(2-Methoxyphenoxy)ethyl]-2-oxo-1H-quinoline-4-carboxamide (CHEBI:149811) is a quinolines (CHEBI:26513) |