EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2O |
| Net Charge | 0 |
| Average Mass | 254.333 |
| Monoisotopic Mass | 254.14191 |
| SMILES | CC(=O)c1cc(-c2ccccc2)nc1N1CCCC1 |
| InChI | InChI=1S/C16H18N2O/c1-12(19)14-11-15(13-7-3-2-4-8-13)17-16(14)18-9-5-6-10-18/h2-4,7-8,11,17H,5-6,9-10H2,1H3 |
| InChIKey | JETWUXIPMDOAEK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(5-Phenyl-2-pyrrolidin-1-yl-1H-pyrrol-3-yl)ethanone (CHEBI:149809) has role anticoronaviral agent (CHEBI:149553) |
| 1-(5-Phenyl-2-pyrrolidin-1-yl-1H-pyrrol-3-yl)ethanone (CHEBI:149809) is a pyrroles (CHEBI:26455) |