EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17ClN2O3S |
| Net Charge | 0 |
| Average Mass | 364.854 |
| Monoisotopic Mass | 364.06484 |
| SMILES | COc1ccc(C2CC(c3cccs3)=NN2C(=O)CCl)cc1OC |
| InChI | InChI=1S/C17H17ClN2O3S/c1-22-14-6-5-11(8-15(14)23-2)13-9-12(16-4-3-7-24-16)19-20(13)17(21)10-18/h3-8,13H,9-10H2,1-2H3 |
| InChIKey | AQTIYCHYBRWPPP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Chloro-1-[5-(3,4-dimethoxyphenyl)-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl]ethan-1-one (CHEBI:149808) has role anticoronaviral agent (CHEBI:149553) |
| 2-Chloro-1-[5-(3,4-dimethoxyphenyl)-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl]ethan-1-one (CHEBI:149808) is a dimethoxybenzene (CHEBI:51681) |