EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17NO5 |
| Net Charge | 0 |
| Average Mass | 339.347 |
| Monoisotopic Mass | 339.11067 |
| SMILES | CCOc1ccc2c(c1)C(=O)C(=O)N2CC1COc2ccccc2O1 |
| InChI | InChI=1S/C19H17NO5/c1-2-23-12-7-8-15-14(9-12)18(21)19(22)20(15)10-13-11-24-16-5-3-4-6-17(16)25-13/h3-9,13H,2,10-11H2,1H3 |
| InChIKey | IAZACPPCXPITJO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(2,3-Dihydro-1,4-benzodioxin-3-ylmethyl)-5-ethoxy-isatin (CHEBI:149807) has role anticoronaviral agent (CHEBI:149553) |
| 1-(2,3-Dihydro-1,4-benzodioxin-3-ylmethyl)-5-ethoxy-isatin (CHEBI:149807) is a benzodioxine (CHEBI:64096) |