EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20BrN3O3.HCl |
| Net Charge | 0 |
| Average Mass | 418.719 |
| Monoisotopic Mass | 417.04548 |
| SMILES | CC(=O)NC1C(=O)N(CCN2CCOCC2)c2ccc(Br)cc21.Cl |
| InChI | InChI=1S/C16H20BrN3O3.ClH/c1-11(21)18-15-13-10-12(17)2-3-14(13)20(16(15)22)5-4-19-6-8-23-9-7-19;/h2-3,10,15H,4-9H2,1H3,(H,18,21);1H |
| InChIKey | UPPVUPVMESYBQL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[5-Bromo-1-(2-morpholin-4-ylethyl)-2-oxo-3H-indol-3-yl]acetamide;hydron;chloride (CHEBI:149801) has role anticoronaviral agent (CHEBI:149553) |
| N-[5-Bromo-1-(2-morpholin-4-ylethyl)-2-oxo-3H-indol-3-yl]acetamide;hydron;chloride (CHEBI:149801) is a N-acyl-amino acid (CHEBI:51569) |