EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O5 |
| Net Charge | 0 |
| Average Mass | 270.240 |
| Monoisotopic Mass | 270.05282 |
| SMILES | Cc1cc(=O)oc2cc(OC(=O)c3ccco3)ccc12 |
| InChI | InChI=1S/C15H10O5/c1-9-7-14(16)20-13-8-10(4-5-11(9)13)19-15(17)12-3-2-6-18-12/h2-8H,1H3 |
| InChIKey | WVAYNWNBGPUATF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4-Methyl-2-oxochromen-7-yl) furan-2-carboxylate (CHEBI:149799) has role anticoronaviral agent (CHEBI:149553) |
| (4-Methyl-2-oxochromen-7-yl) furan-2-carboxylate (CHEBI:149799) is a coumarins (CHEBI:23403) |