EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H25N5O5 |
| Net Charge | 0 |
| Average Mass | 499.527 |
| Monoisotopic Mass | 499.18557 |
| SMILES | COc1cccc(C(C(=O)NCc2ccco2)N(Cc2ccco2)C(=O)Cn2nnc3ccccc32)c1 |
| InChI | InChI=1S/C27H25N5O5/c1-35-20-8-4-7-19(15-20)26(27(34)28-16-21-9-5-13-36-21)31(17-22-10-6-14-37-22)25(33)18-32-24-12-3-2-11-23(24)29-30-32/h2-15,26H,16-18H2,1H3,(H,28,34) |
| InChIKey | GROOCDCQBXOOCH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CID 3206295 (CHEBI:149798) has functional parent α-amino acid (CHEBI:33704) |
| CID 3206295 (CHEBI:149798) has role anticoronaviral agent (CHEBI:149553) |
| CID 3206295 (CHEBI:149798) is a organonitrogen compound (CHEBI:35352) |
| CID 3206295 (CHEBI:149798) is a organooxygen compound (CHEBI:36963) |