EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15ClF2N2O3S |
| Net Charge | 0 |
| Average Mass | 400.834 |
| Monoisotopic Mass | 400.04600 |
| SMILES | COc1cc(C2CC(c3cccs3)=NN2C(=O)CCl)ccc1OC(F)F |
| InChI | InChI=1S/C17H15ClF2N2O3S/c1-24-14-7-10(4-5-13(14)25-17(19)20)12-8-11(15-3-2-6-26-15)21-22(12)16(23)9-18/h2-7,12,17H,8-9H2,1H3 |
| InChIKey | DUDITNSSGPGFJY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(Chloroacetyl)-5-[4-(difluoromethoxy)-3-methoxyphenyl]-3-thien-2-yl-4,5-dihydro-1H-pyrazole (CHEBI:149795) has role anticoronaviral agent (CHEBI:149553) |
| 1-(Chloroacetyl)-5-[4-(difluoromethoxy)-3-methoxyphenyl]-3-thien-2-yl-4,5-dihydro-1H-pyrazole (CHEBI:149795) is a methoxybenzenes (CHEBI:51683) |