EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H15N3O5 |
| Net Charge | 0 |
| Average Mass | 413.389 |
| Monoisotopic Mass | 413.10117 |
| SMILES | O=C(O)c1ccc(/C=C2\C(=O)N(c3cccc([N+](=O)[O-])c3)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H15N3O5/c27-22-20(13-15-9-11-17(12-10-15)23(28)29)21(16-5-2-1-3-6-16)24-25(22)18-7-4-8-19(14-18)26(30)31/h1-14H,(H,28,29)/b20-13- |
| InChIKey | YZVRXPHVOKGNEW-MOSHPQCFSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[(Z)-[1-(3-Nitrophenyl)-5-oxo-3-phenylpyrazol-4-ylidene]methyl]benzoic acid (CHEBI:149794) has role anticoronaviral agent (CHEBI:149553) |
| 4-[(Z)-[1-(3-Nitrophenyl)-5-oxo-3-phenylpyrazol-4-ylidene]methyl]benzoic acid (CHEBI:149794) is a C-nitro compound (CHEBI:35716) |