EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H15FN2O3 |
| Net Charge | 0 |
| Average Mass | 386.382 |
| Monoisotopic Mass | 386.10667 |
| SMILES | O=C(O)c1ccc(/C=C2\C(=O)N(c3ccc(F)cc3)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H15FN2O3/c24-18-10-12-19(13-11-18)26-22(27)20(21(25-26)16-4-2-1-3-5-16)14-15-6-8-17(9-7-15)23(28)29/h1-14H,(H,28,29)/b20-14- |
| InChIKey | ORQDYVINJXCMJR-ZHZULCJRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[(Z)-[1-(4-Fluorophenyl)-5-oxo-3-phenylpyrazol-4-ylidene]methyl]benzoic acid (CHEBI:149793) has role anticoronaviral agent (CHEBI:149553) |
| 4-[(Z)-[1-(4-Fluorophenyl)-5-oxo-3-phenylpyrazol-4-ylidene]methyl]benzoic acid (CHEBI:149793) is a benzoic acids (CHEBI:22723) |