EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30N2O2 |
| Net Charge | 0 |
| Average Mass | 402.538 |
| Monoisotopic Mass | 402.23073 |
| SMILES | COc1cccc(CNC(=O)C2CCN([C@H](C)c3cccc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C26H30N2O2/c1-19(24-12-6-9-21-8-3-4-11-25(21)24)28-15-13-22(14-16-28)26(29)27-18-20-7-5-10-23(17-20)30-2/h3-12,17,19,22H,13-16,18H2,1-2H3,(H,27,29)/t19-/m1/s1 |
| InChIKey | QKYBTDRNPVPOGN-LJQANCHMSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(3-Methoxyphenyl)methyl]-1-[(1R)-1-naphthalen-1-ylethyl]piperidine-4-carboxamide (CHEBI:149789) has role anticoronaviral agent (CHEBI:149553) |
| N-[(3-Methoxyphenyl)methyl]-1-[(1R)-1-naphthalen-1-ylethyl]piperidine-4-carboxamide (CHEBI:149789) is a naphthalenes (CHEBI:25477) |