EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17FN8O2 |
| Net Charge | 0 |
| Average Mass | 408.397 |
| Monoisotopic Mass | 408.14585 |
| SMILES | COC(=O)Nc1c(N)nc(-c2nn(Cc3ccccc3F)c3ncccc23)nc1N |
| InChI | InChI=1S/C19H17FN8O2/c1-30-19(29)24-14-15(21)25-17(26-16(14)22)13-11-6-4-8-23-18(11)28(27-13)9-10-5-2-3-7-12(10)20/h2-8H,9H2,1H3,(H,24,29)(H4,21,22,25,26) |
| InChIKey | FTQHGWIXJSSWOY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | soluble guanylate cyclase activator Any compound that binds to and activates soluble guanylate cyclase (EC 4.6.1.2). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nelociguat (CHEBI:149785) has role antihypertensive agent (CHEBI:35674) |
| nelociguat (CHEBI:149785) has role drug metabolite (CHEBI:49103) |
| nelociguat (CHEBI:149785) has role soluble guanylate cyclase activator (CHEBI:76022) |
| nelociguat (CHEBI:149785) has role vasodilator agent (CHEBI:35620) |
| nelociguat (CHEBI:149785) is a aminopyrimidine (CHEBI:38338) |
| nelociguat (CHEBI:149785) is a carbamate ester (CHEBI:23003) |
| nelociguat (CHEBI:149785) is a monofluorobenzenes (CHEBI:83575) |
| nelociguat (CHEBI:149785) is a pyrazolopyridine (CHEBI:46699) |
| IUPAC Name |
|---|
| methyl {4,6-diamino-2-[1-(2-fluorobenzyl)-1H-pyrazolo[3,4-b]pyridin-3-yl]pyrimidin-5-yl}carbamate |
| INNs | Source |
|---|---|
| nelociguatum | WHO MedNet |
| nelociguat | WHO MedNet |
| nélociguat | WHO MedNet |
| nelociguat | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY60-4552 | SUBMITTER |
| methyl (4,6-diamino-2-{1-[(2-fluorophenyl)methyl]-1H-pyrazolo[3,4-b]pyridin-3-yl}pyrimidin-5-yl)carbamate | IUPAC |
| BAY 60-4552 | ChemIDplus |
| BAY-60-4552 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| WO2011073118 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:625115-52-8 | ChemIDplus |
| Citations |
|---|