EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3ClO3 |
| Net Charge | 0 |
| Average Mass | 158.540 |
| Monoisotopic Mass | 157.97707 |
| SMILES | O=C1C=C(O)C(=O)C(Cl)=C1 |
| InChI | InChI=1S/C6H3ClO3/c7-4-1-3(8)2-5(9)6(4)10/h1-2,9H |
| InChIKey | IRXYWXQHJBMURT-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-chloro-6-hydroxy-1,4-benzoquinone (CHEBI:149783) is a monohydroxy-1,4-benzoquinones (CHEBI:67273) |
| 2-chloro-6-hydroxy-1,4-benzoquinone (CHEBI:149783) is a organochlorine compound (CHEBI:36683) |
| 2-chloro-6-hydroxy-1,4-benzoquinone (CHEBI:149783) is conjugate acid of 2-chloro-6-hydroxy-1,4-benzoquinone(1−) (CHEBI:147300) |
| Incoming Relation(s) |
| 2-chloro-6-hydroxy-1,4-benzoquinone(1−) (CHEBI:147300) is conjugate base of 2-chloro-6-hydroxy-1,4-benzoquinone (CHEBI:149783) |
| IUPAC Name |
|---|
| 2-chloro-6-hydroxycyclohexa-2,5-diene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2-chlorohydroxyquinone | ChEBI |
| 6-chlorohydroxyquinone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-22340 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:681490-35-7 | ChEBI |
| Citations |
|---|