EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H20BrClN6O3 |
| Net Charge | 0 |
| Average Mass | 555.820 |
| Monoisotopic Mass | 554.04688 |
| SMILES | CCCCc1nc(Cl)c(C(=O)O)n1Cc1ccc2oc(-c3ccccc3-c3nnnn3)c(Br)c2c1 |
| InChI | InChI=1S/C24H20BrClN6O3/c1-2-3-8-18-27-22(26)20(24(33)34)32(18)12-13-9-10-17-16(11-13)19(25)21(35-17)14-6-4-5-7-15(14)23-28-30-31-29-23/h4-7,9-11H,2-3,8,12H2,1H3,(H,33,34)(H,28,29,30,31) |
| InChIKey | FIKYECRHLXONOX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zolasartan (CHEBI:149761) has role angiotensin receptor antagonist (CHEBI:61016) |
| zolasartan (CHEBI:149761) has role antihypertensive agent (CHEBI:35674) |
| zolasartan (CHEBI:149761) is a 1-benzofurans (CHEBI:38830) |
| zolasartan (CHEBI:149761) is a biaryl (CHEBI:64459) |
| zolasartan (CHEBI:149761) is a imidazolyl carboxylic acid (CHEBI:38307) |
| zolasartan (CHEBI:149761) is a monocarboxylic acid (CHEBI:25384) |
| zolasartan (CHEBI:149761) is a organobromine compound (CHEBI:37141) |
| zolasartan (CHEBI:149761) is a organochlorine compound (CHEBI:36683) |
| zolasartan (CHEBI:149761) is a tetrazoles (CHEBI:35689) |
| zolasartan (CHEBI:149761) is conjugate acid of zolasartan(2−) (CHEBI:149524) |
| Incoming Relation(s) |
| zolasartan(2−) (CHEBI:149524) is conjugate base of zolasartan (CHEBI:149761) |
| IUPAC Name |
|---|
| 1-({3-bromo-2-[2-(1H-tetrazol-5-yl)phenyl]-1-benzofuran-5-yl}methyl)-2-butyl-4-chloro-1H-imidazole-5-carboxylic acid |
| INNs | Source |
|---|---|
| zolasartan | WHO MedNet |
| zolasartan | WHO MedNet |
| zolasartán | WHO MedNet |
| zolasartanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-((3-bromo-2-(o-1H-tetrazol-5-ylphenyl)-5-benzofuranyl)methyl)-2-butyl-4-chloroimidazole-5-carboxylic acid | ChEBI |
| GR 117289 | ChemIDplus |
| GR-117289 | ChEBI |
| GR117289 | ChEBI |
| GR 117289C | ChemIDplus |
| GR-117289C | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:145781-32-4 | ChemIDplus |
| Citations |
|---|