EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | C[C@]([NH3+])(CO)C(=O)[O-] |
| InChI | InChI=1S/C4H9NO3/c1-4(5,2-6)3(7)8/h6H,2,5H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | CDUUKBXTEOFITR-BYPYZUCNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-L-serine zwitterion (CHEBI:149759) is a amino-acid zwitterion (CHEBI:35238) |
| 2-methyl-L-serine zwitterion (CHEBI:149759) is tautomer of 2-methyl-L-serine (CHEBI:74819) |
| Incoming Relation(s) |
| 2-methyl-L-serine (CHEBI:74819) is tautomer of 2-methyl-L-serine zwitterion (CHEBI:149759) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-hydroxy-2-methylpropanoate |
| Synonyms | Source |
|---|---|
| (S)-(+)-2-amino-3-hydroxy-2-methylpropionate | MetaCyc |
| (S)-2-methylserine zwitterion | ChEBI |
| (S)-α-MeSer zwitterion | ChEBI |
| α-methyl-L-serine zwitterion | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 2-methyl-L-serine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2-METHYL-L-SERINE | MetaCyc |