EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N4O3 |
| Net Charge | 0 |
| Average Mass | 222.204 |
| Monoisotopic Mass | 222.07529 |
| SMILES | Cc1cn(CCO)c2nc(=O)nc(=O)c-2n1 |
| InChI | InChI=1S/C9H10N4O3/c1-5-4-13(2-3-14)7-6(10-5)8(15)12-9(16)11-7/h4,14H,2-3H2,1H3,(H,12,15,16) |
| InChIKey | UEFFYLLEAIHMNT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-(2-hydroxyethyl)-6-methyllumazine (CHEBI:149754) has functional parent lumazine (CHEBI:16489) |
| 8-(2-hydroxyethyl)-6-methyllumazine (CHEBI:149754) has role epitope (CHEBI:53000) |
| 8-(2-hydroxyethyl)-6-methyllumazine (CHEBI:149754) is a pteridines (CHEBI:26373) |
| IUPAC Name |
|---|
| 8-(2-hydroxyethyl)-6-methylpteridine-2,4(3H,8H)-dione |
| Synonyms | Source |
|---|---|
| 8-(2-hydroxyethyl)-6-methyl-2,4(3H,8H)-pteridinedione | ChEBI |
| 2'-OH-butyl-L-6-Me | ChEBI |
| Citations |
|---|