EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N4O4 |
| Net Charge | 0 |
| Average Mass | 268.273 |
| Monoisotopic Mass | 268.11715 |
| SMILES | CC(=O)/C=N/c1c(NCCCCO)nc(=O)nc1=O |
| InChI | InChI=1S/C11H16N4O4/c1-7(17)6-13-8-9(12-4-2-3-5-16)14-11(19)15-10(8)18/h6,16H,2-5H2,1H3,(H3,12,14,15,18,19)/b13-6+ |
| InChIKey | OCPAQIZKGXRILZ-AWNIVKPZSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-[(4-hydroxybutyl)amino]-5-[(E)-(2-oxopropylidene)amino]uracil (CHEBI:149748) has functional parent uracil (CHEBI:17568) |
| 6-[(4-hydroxybutyl)amino]-5-[(E)-(2-oxopropylidene)amino]uracil (CHEBI:149748) has role epitope (CHEBI:53000) |
| 6-[(4-hydroxybutyl)amino]-5-[(E)-(2-oxopropylidene)amino]uracil (CHEBI:149748) is a nucleobase analogue (CHEBI:67142) |
| 6-[(4-hydroxybutyl)amino]-5-[(E)-(2-oxopropylidene)amino]uracil (CHEBI:149748) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 6-[(4-hydroxybutyl)amino]-5-[(E)-(2-oxopropylidene)amino]pyrimidine-2,4(1H,3H)-dione |
| Synonyms | Source |
|---|---|
| 6-[(4-hydroxybutyl)amino]-5-[[(1E)-2-oxopropylidene]amino]-2,4(1H,3H)-pyrimidinedione | ChEBI |
| 4'-OH-butyl-5-OP-U | ChEBI |
| Citations |
|---|