EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O7 |
| Net Charge | 0 |
| Average Mass | 328.321 |
| Monoisotopic Mass | 328.12705 |
| SMILES | CC(=O)/C=C/c1c(CC[C@H](O)[C@H](O)[C@H](O)CO)nc(=O)nc1=O |
| InChI | InChI=1S/C14H20N2O7/c1-7(18)2-3-8-9(15-14(23)16-13(8)22)4-5-10(19)12(21)11(20)6-17/h2-3,10-12,17,19-21H,4-6H2,1H3,(H2,15,16,22,23)/b3-2+/t10-,11+,12-/m0/s1 |
| InChIKey | YIGUGMFHMVTCHU-VUGGRDAHSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-[(1-deoxy-D-ribityl)methyl]-5-[(1E)-3-oxobut-1-en-1-yl]uracil (CHEBI:149716) has functional parent uracil (CHEBI:17568) |
| 6-[(1-deoxy-D-ribityl)methyl]-5-[(1E)-3-oxobut-1-en-1-yl]uracil (CHEBI:149716) has role epitope (CHEBI:53000) |
| 6-[(1-deoxy-D-ribityl)methyl]-5-[(1E)-3-oxobut-1-en-1-yl]uracil (CHEBI:149716) is a nucleobase analogue (CHEBI:67142) |
| 6-[(1-deoxy-D-ribityl)methyl]-5-[(1E)-3-oxobut-1-en-1-yl]uracil (CHEBI:149716) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 1,2-dideoxy-1-{2,6-dioxo-5-[(1E)-3-oxobut-1-en-1-yl]-1,2,3,6-tetrahydropyrimidin-4-yl}-D-ribo-hexitol |
| Synonym | Source |
|---|---|
| 1,2-dideoxy-1-[1,2,3,6-tetrahydro-2,6-dioxo-5-[(1E)-3-oxo-1-buten-1-yl]-4-pyrimidinyl]-D-ribo-hexitol | ChEBI |
| Citations |
|---|