EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N2O3 |
| Net Charge | 0 |
| Average Mass | 194.190 |
| Monoisotopic Mass | 194.06914 |
| SMILES | CC(=O)/C=C/c1c(C)nc(=O)nc1=O |
| InChI | InChI=1S/C9H10N2O3/c1-5(12)3-4-7-6(2)10-9(14)11-8(7)13/h3-4H,1-2H3,(H2,10,11,13,14)/b4-3+ |
| InChIKey | BUVNCCASAGRUIE-ONEGZZNKSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methyl-5-[(1E)-3-oxobut-1-en-1-yl]uracil (CHEBI:149702) has functional parent uracil (CHEBI:17568) |
| 6-methyl-5-[(1E)-3-oxobut-1-en-1-yl]uracil (CHEBI:149702) has role epitope (CHEBI:53000) |
| 6-methyl-5-[(1E)-3-oxobut-1-en-1-yl]uracil (CHEBI:149702) is a nucleobase analogue (CHEBI:67142) |
| 6-methyl-5-[(1E)-3-oxobut-1-en-1-yl]uracil (CHEBI:149702) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 6-methyl-5-[(1E)-3-oxobut-1-en-1-yl]pyrimidine-2,4(1H,3H)-dione |
| Synonym | Source |
|---|---|
| 6-methyl-5-[(1E)-3-oxo-1-buten1-yl]-2,4(1H,3H)-pyrimidinedione | ChEBI |
| Citations |
|---|