EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11NOS2 |
| Net Charge | 0 |
| Average Mass | 249.360 |
| Monoisotopic Mass | 249.02821 |
| SMILES | [H]C(=C1SC(=S)NC1=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C12H11NOS2/c1-2-8-3-5-9(6-4-8)7-10-11(14)13-12(15)16-10/h3-7H,2H2,1H3,(H,13,14,15) |
| InChIKey | SVXDHPADAXBMFB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10058-F4 (CHEBI:149696) has role antineoplastic agent (CHEBI:35610) |
| 10058-F4 (CHEBI:149696) has role apoptosis inducer (CHEBI:68495) |
| 10058-F4 (CHEBI:149696) is a olefinic compound (CHEBI:78840) |
| 10058-F4 (CHEBI:149696) is a thiazolidinone (CHEBI:48891) |
| IUPAC Name |
|---|
| 5-(4-ethylbenzylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| Synonyms | Source |
|---|---|
| 5-[(4-ethylphenyl)methylene]-2-thioxo-4-thiazolidinone | ChEBI |
| 5-(4-ethylbenzylidene)-2-thioxothiazolidin-4-one | ChemIDplus |
| 10058F4 | ChemIDplus |
| 5-(4-ethylbenzylidene)-2-mercapto-1,3-thiazol-4(5H)-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:403811-55-2 | ChemIDplus |
| Citations |
|---|