EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O2 |
| Net Charge | 0 |
| Average Mass | 150.177 |
| Monoisotopic Mass | 150.06808 |
| SMILES | CC(=O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C9H10O2/c1-7(10)9(11)8-5-3-2-4-6-8/h2-6,9,11H,1H3/t9-/m0/s1 |
| InChIKey | ZBFFNPODXBJBPW-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | cell suspension culture (BTO:0000221) | PubMed (31733223) |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-phenylacetylcarbinol (CHEBI:149671) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| (R)-phenylacetylcarbinol (CHEBI:149671) is a 1-hydroxy-1-phenylpropan-2-one (CHEBI:149767) |
| (R)-phenylacetylcarbinol (CHEBI:149671) is enantiomer of (S)-phenylacetylcarbinol (CHEBI:149670) |
| Incoming Relation(s) |
| rac-phenylacetylcarbinol (CHEBI:149766) has part (R)-phenylacetylcarbinol (CHEBI:149671) |
| (S)-phenylacetylcarbinol (CHEBI:149670) is enantiomer of (R)-phenylacetylcarbinol (CHEBI:149671) |
| IUPAC Name |
|---|
| (1R)-1-hydroxy-1-phenylpropan-2-one |
| Synonyms | Source |
|---|---|
| (R)-1-hydroxy-1-phenylpropan-2-one | SUBMITTER |
| (R)-PAC | MetaCyc |
| (1R)-phenylacetylcarbinol | ChEBI |
| (R)-1-hydroxy-1-phenyl-2-propanone | ChEBI |
| (−)-phenylacetylcarbinol | ChemIDplus |
| (R)-1-hydroxy-1-phenylacetone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (R)-phenylacetylcarbinol | UniProt |
| Citations |
|---|