EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60H102N22O15S |
| Net Charge | 0 |
| Average Mass | 1403.682 |
| Monoisotopic Mass | 1402.76157 |
| SMILES | CSCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCC(N)=O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C60H102N22O15S/c1-33(2)27-40(77-50(88)37(12-6-21-69-59(64)65)74-55(93)44-15-9-24-81(44)56(94)38(13-7-22-70-60(66)67)75-48(86)35(62)17-18-46(63)84)51(89)79-42(31-83)53(91)78-41(28-34-29-68-32-72-34)52(90)73-36(11-4-5-20-61)49(87)71-30-47(85)80-23-8-14-43(80)54(92)76-39(19-26-98-3)57(95)82-25-10-16-45(82)58(96)97/h29,32-33,35-45,83H,4-28,30-31,61-62H2,1-3H3,(H2,63,84)(H,68,72)(H,71,87)(H,73,90)(H,74,93)(H,75,86)(H,76,92)(H,77,88)(H,78,91)(H,79,89)(H,96,97)(H4,64,65,69)(H4,66,67,70)/t35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,45-/m0/s1 |
| InChIKey | QZNKGTRFBWGADN-SLUWFFAESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | PubMed (31321006) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apelin-12 (CHEBI:149669) has role biomarker (CHEBI:59163) |
| apelin-12 (CHEBI:149669) has role human blood serum metabolite (CHEBI:85234) |
| apelin-12 (CHEBI:149669) has role human metabolite (CHEBI:77746) |
| apelin-12 (CHEBI:149669) has role neuroprotective agent (CHEBI:63726) |
| apelin-12 (CHEBI:149669) is a oligopeptide (CHEBI:25676) |
| apelin-12 (CHEBI:149669) is conjugate base of apelin-12(3+) (CHEBI:147396) |
| Incoming Relation(s) |
| apelin-12(3+) (CHEBI:147396) is conjugate acid of apelin-12 (CHEBI:149669) |
| IUPAC Name |
|---|
| L-glutaminyl-L-arginyl-L-prolyl-L-arginyl-L-leucyl-L-seryl-L-histidyl-L-lysylglycyl-L-prolyl-L-methionyl-L-proline |
| Synonyms | Source |
|---|---|
| Q-R-P-R-L-S-H-K-G-P-M-P | ChEBI |
| H-Gln-Arg-Pro-Arg-Leu-Ser-His-Lys-Gly-Pro-Met-Pro-OH | ChEBI |
| QRPRLSHKGPMP | ChEBI |
| apelin-12 (human) | ChEBI |
| apelin-13 (1-12) | ChEBI |
| Gln-Arg-Pro-Arg-Leu-Ser-His-Lys-Gly-Pro-Met-Pro | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060264 | HMDB |
| Citations |
|---|