EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25O7P2 |
| Net Charge | -3 |
| Average Mass | 379.306 |
| Monoisotopic Mass | 379.10920 |
| SMILES | [H][C@@]12CC=C(C)[C@H](COP(=O)([O-])OP(=O)([O-])[O-])[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C15H28O7P2/c1-11-6-7-13-14(2,3)8-5-9-15(13,4)12(11)10-21-24(19,20)22-23(16,17)18/h6,12-13H,5,7-10H2,1-4H3,(H,19,20)(H2,16,17,18)/p-3/t12-,13-,15+/m0/s1 |
| InChIKey | SSOUWUHBWJPFIP-KCQAQPDRSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5S,9S,10S)-drim-7-en-11-yl diphosphate(3−) (CHEBI:149665) has functional parent drimenol (CHEBI:61148) |
| (5S,9S,10S)-drim-7-en-11-yl diphosphate(3−) (CHEBI:149665) is a octahydronaphthalenes (CHEBI:138397) |
| (5S,9S,10S)-drim-7-en-11-yl diphosphate(3−) (CHEBI:149665) is a organophosphate oxoanion (CHEBI:58945) |
| (5S,9S,10S)-drim-7-en-11-yl diphosphate(3−) (CHEBI:149665) is a sesquiterpenoid (CHEBI:26658) |
| (5S,9S,10S)-drim-7-en-11-yl diphosphate(3−) (CHEBI:149665) is conjugate base of Drimenyl diphosphate (CHEBI:228356) |
| Incoming Relation(s) |
| Drimenyl diphosphate (CHEBI:228356) is conjugate acid of (5S,9S,10S)-drim-7-en-11-yl diphosphate(3−) (CHEBI:149665) |
| Synonyms | Source |
|---|---|
| drimenyl pyrophosphate | SUBMITTER |
| drimenyl diphosphate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (5S,9S,10S)-drim-7-en-11-yl diphosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20472 | MetaCyc |
| Citations |
|---|