EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12O6 |
| Net Charge | 0 |
| Average Mass | 324.288 |
| Monoisotopic Mass | 324.06339 |
| SMILES | O=C1C(O)=C(c2ccc(O)cc2)C(=O)C(O)=C1c1ccc(O)cc1 |
| InChI | InChI=1S/C18H12O6/c19-11-5-1-9(2-6-11)13-15(21)17(23)14(18(24)16(13)22)10-3-7-12(20)8-4-10/h1-8,19-21,24H |
| InChIKey | FKQQKMGWCJGUCS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clitocybe subilludens (ncbitaxon:210149) | |||
| cell suspension culture (BTO:0000221) | PubMed (4332377) | ||
| - | PubMed (5815216) | ||
| Fungi (ncbitaxon:4751) | cell suspension culture (BTO:0000221) | PubMed (17323650) | Isolated from the solid state fermentation of an unidentified fungus F010248. Strain: F010248 |
| Hydnellum diabolus (ncbitaxon:176618) | - | PubMed (5862512) | |
| Hypoxylon fendleri (ncbitaxon:558530) | |||
| cell suspension culture (BTO:0000221) | PubMed (28384525) | ||
| cell suspension culture (BTO:0000221) | PubMed (31476402) | Strain: BCC32408 | |
| Paxillus panuoides (ncbitaxon:80604) | - | PubMed (5166969) | Identified in the carpophores. |
| Thelephora aurantiotincta (ncbitaxon:654496) | fruit body (BTO:0000487) | PubMed (12895540) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.3.1.9 [enoyl-[acyl-carrier-protein] reductase (NADH)] inhibitor An EC 1.3.1.* (oxidoreductase acting on donor CH-CH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of enoyl-[acyl-carrier-protein] reductase (NADH), EC 1.3.1.9. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atromentin (CHEBI:149660) has role antibacterial agent (CHEBI:33282) |
| atromentin (CHEBI:149660) has role anticoagulant (CHEBI:50249) |
| atromentin (CHEBI:149660) has role antineoplastic agent (CHEBI:35610) |
| atromentin (CHEBI:149660) has role apoptosis inducer (CHEBI:68495) |
| atromentin (CHEBI:149660) has role biological pigment (CHEBI:26130) |
| atromentin (CHEBI:149660) has role EC 1.3.1.9 [enoyl-[acyl-carrier-protein] reductase (NADH)] inhibitor (CHEBI:139512) |
| atromentin (CHEBI:149660) has role fungal metabolite (CHEBI:76946) |
| atromentin (CHEBI:149660) is a dihydroxy-1,4-benzoquinones (CHEBI:132126) |
| atromentin (CHEBI:149660) is a polyphenol (CHEBI:26195) |
| atromentin (CHEBI:149660) is conjugate acid of atromentin(1−) (CHEBI:149642) |
| Incoming Relation(s) |
| atromentin(1−) (CHEBI:149642) is conjugate base of atromentin (CHEBI:149660) |
| IUPAC Name |
|---|
| 3',4,4'',6'-tetrahydroxy[1,1':4',1''-terphenyl]-2',5'-dione |
| Synonyms | Source |
|---|---|
| 14,23,26,34-tetrahydroxy[11,21:24,31-terphenyl]-22,25-dione | IUPAC |
| 2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)-1,4-benzoquinone | MetaCyc |
| 2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)cyclohexa-2,5-diene-1,4-dione | ChEBI |
| 2,5-dihydroxy-3,6-bis(p-hydroxyphenyl)-p-benzoquinone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Atromentin | Wikipedia |
| C00036784 | KNApSAcK |
| CPD-14619 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:519-67-5 | ChemIDplus |
| Citations |
|---|