EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H41N5O9 |
| Net Charge | 0 |
| Average Mass | 603.673 |
| Monoisotopic Mass | 603.29043 |
| SMILES | CC(C)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](CCC(=O)O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C29H41N5O9/c1-16(2)24(26(39)31-20(11-12-23(36)37)28(41)34-14-4-6-22(34)29(42)43)32-25(38)21-5-3-13-33(21)27(40)19(30)15-17-7-9-18(35)10-8-17/h7-10,16,19-22,24,35H,3-6,11-15,30H2,1-2H3,(H,31,39)(H,32,38)(H,36,37)(H,42,43)/t19-,20-,21-,22-,24-/m0/s1 |
| InChIKey | WRNQQFNBEUKAAX-YGQNSOCVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-casochemotide-1 (CHEBI:149657) has role human metabolite (CHEBI:77746) |
| β-casochemotide-1 (CHEBI:149657) has role mammalian metabolite (CHEBI:75768) |
| β-casochemotide-1 (CHEBI:149657) is a oligopeptide (CHEBI:25676) |
| β-casochemotide-1 (CHEBI:149657) is conjugate acid of |
| Incoming Relation(s) |
| IUPAC Name |
|---|
| L-tyrosyl-L-prolyl-L-valyl-L-α-glutamyl-L-proline |
| Synonyms | Source |
|---|---|
| H-Tyr-Pro-Val-Glu-Pro-OH | ChEBI |
| neocasomorphin (1-5) | ChEBI |
| neocasomorphin-(1-5) | ChEBI |
| neocasomorphin-5 | ChEBI |
| L-Tyr-L-Pro-L-Val-L-Glu-L-Pro | ChEBI |
| Tyr-Pro-Val-Glu-Pro | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060144 | HMDB |
| WO2004092206 | Patent |
| Citations |
|---|