EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | Nc1ccccc1CC(=O)O |
| InChI | InChI=1S/C8H9NO2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5,9H2,(H,10,11) |
| InChIKey | KHMNCHDUSFCTGK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum gloeosporioides (ncbitaxon:474922) | - | PubMed (25421415) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminophenylacetic acid (CHEBI:149652) has role fungal metabolite (CHEBI:76946) |
| 2-aminophenylacetic acid (CHEBI:149652) is a phenylacetic acids (CHEBI:25978) |
| 2-aminophenylacetic acid (CHEBI:149652) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| (2-aminophenyl)acetic acid |
| Synonym | Source |
|---|---|
| 2-amino-benzeneacetic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO02096403 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:3342-78-7 | ChEBI |
| Citations |
|---|