EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H32O2 |
| Net Charge | 0 |
| Average Mass | 256.430 |
| Monoisotopic Mass | 256.24023 |
| SMILES | CC(C)CCC(C)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C16H32O2/c1-14(2)12-13-15(3)10-8-6-4-5-7-9-11-16(17)18/h14-15H,4-13H2,1-3H3,(H,17,18) |
| InChIKey | PWLJNEGUWOGTSF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Agelas dispar (ncbitaxon:295252) | - | PubMed (12558052) | |
| Calyx podatypa (ncbitaxon:295247) | - | PubMed (10843583) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10,13-dimethyltetradecanoic acid (CHEBI:149651) has role animal metabolite (CHEBI:75767) |
| 10,13-dimethyltetradecanoic acid (CHEBI:149651) has role marine metabolite (CHEBI:76507) |
| 10,13-dimethyltetradecanoic acid (CHEBI:149651) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 10,13-dimethyltetradecanoic acid (CHEBI:149651) is a long-chain fatty acid (CHEBI:15904) |
| 10,13-dimethyltetradecanoic acid (CHEBI:149651) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| 10,13-dimethyltetradecanoic acid |
| Synonyms | Source |
|---|---|
| 10,13-dimethylmyristic acid | ChEBI |
| 10,13-dimethyltetradecanoic (16:0) | ChEBI |
| 14:0(10Me,13Me) | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020355 | LIPID MAPS |
| Citations |
|---|