EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:149640 - β-casomorphin-6 (human)
| Formula | C38H50N6O10 |
| Net Charge | 0 |
| Average Mass | 750.850 |
| Monoisotopic Mass | 750.35884 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](CCC(=O)O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C38H50N6O10/c1-22(2)32(35(50)40-27(16-17-31(46)47)37(52)44-19-7-11-30(44)38(53)54)42-33(48)28(21-23-8-4-3-5-9-23)41-34(49)29-10-6-18-43(29)36(51)26(39)20-24-12-14-25(45)15-13-24/h3-5,8-9,12-15,22,26-30,32,45H,6-7,10-11,16-21,39H2,1-2H3,(H,40,50)(H,41,49)(H,42,48)(H,46,47)(H,53,54)/t26-,27-,28-,29-,30-,32-/m0/s1 |
| InChIKey | WUHXJZCLFYNVBB-RUAREOIKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-casomorphin-6 (human) (CHEBI:149640) has role human metabolite (CHEBI:77746) |
| β-casomorphin-6 (human) (CHEBI:149640) is a oligopeptide (CHEBI:25676) |
| β-casomorphin-6 (human) (CHEBI:149640) is conjugate acid of β-casomorphin-6 (human)(1−) (CHEBI:147391) |
| Incoming Relation(s) |
| β-casomorphin-6 (human)(1−) (CHEBI:147391) is conjugate base of β-casomorphin-6 (human) (CHEBI:149640) |
| IUPAC Name |
|---|
| L-tyrosyl-L-prolyl-L-phenylalanyl-L-valyl-L-α-glutamyl-L-proline |
| Synonyms | Source |
|---|---|
| L-Tyr-L-Pro-L-Phe-L-Val-L-Glu-L-Pro | ChEBI |
| Tyr-Pro-Phe-Val-Glu-Pro | ChEBI |
| NH2-Tyr-Pro-Phe-Val-Glu-Pro-COOH | ChEBI |
| H-Tyr-Pro-Phe-Val-Glu-Pro-OH | ChEBI |
| YPFVEP | ChEBI |
| human β-casomorphin-6 | ChEBI |
| Citations |
|---|