EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N2O3 |
| Net Charge | 0 |
| Average Mass | 234.255 |
| Monoisotopic Mass | 234.10044 |
| SMILES | COc1ccc2ncc(C[C@H]([NH3+])C(=O)[O-])c2c1 |
| InChI | InChI=1S/C12H14N2O3/c1-17-8-2-3-11-9(5-8)7(6-14-11)4-10(13)12(15)16/h2-3,5-6,10,14H,4,13H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | KVNPSKDDJARYKK-JTQLQIEISA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methoxy-L-tryptophan zwitterion (CHEBI:149637) is a L-α-amino acid zwitterion (CHEBI:59869) |
| 5-methoxy-L-tryptophan zwitterion (CHEBI:149637) is tautomer of 5-methoxytryptophan (CHEBI:74049) |
| Incoming Relation(s) |
| 5-methoxytryptophan (CHEBI:74049) is tautomer of 5-methoxy-L-tryptophan zwitterion (CHEBI:149637) |
| Synonym | Source |
|---|---|
| 5-methoxytryptophan zwitterion | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 5-methoxy-L-tryptophan | UniProt |
| Citations |
|---|