EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12O5 |
| Net Charge | 0 |
| Average Mass | 296.278 |
| Monoisotopic Mass | 296.06847 |
| SMILES | O=C1O/C(=C/c2ccc(O)cc2)C(O)=C1c1ccc(O)cc1 |
| InChI | InChI=1S/C17H12O5/c18-12-5-1-10(2-6-12)9-14-16(20)15(17(21)22-14)11-3-7-13(19)8-4-11/h1-9,18-20H/b14-9+ |
| InChIKey | BNNVVTQUWNGKPH-NTEUORMPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus terreus (ncbitaxon:33178) | |||
| - | PubMed (23411074) | Strain: Gwq-48 | |
| cell suspension culture (BTO:0000221) | DOI (10.1007/s00044-014-1164-0) | Strain: RCC1 |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoaspulvinone E (CHEBI:149619) has role Aspergillus metabolite (CHEBI:76956) |
| isoaspulvinone E (CHEBI:149619) has role antiviral agent (CHEBI:22587) |
| isoaspulvinone E (CHEBI:149619) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| isoaspulvinone E (CHEBI:149619) has role marine metabolite (CHEBI:76507) |
| isoaspulvinone E (CHEBI:149619) is a 4-hydroxy-5-(4-hydroxybenzylidene)-3-(4-hydroxyphenyl)furan-2(5H)-one (CHEBI:155902) |
| isoaspulvinone E (CHEBI:149619) is a aspulvinone (CHEBI:22669) |
| isoaspulvinone E (CHEBI:149619) is conjugate acid of isoaspulvinone E(1−) (CHEBI:149620) |
| Incoming Relation(s) |
| isoaspulvinone E(1−) (CHEBI:149620) is conjugate base of isoaspulvinone E (CHEBI:149619) |
| IUPAC Name |
|---|
| (5E)-4-hydroxy-5-(4-hydroxybenzylidene)-3-(4-hydroxyphenyl)furan-2(5H)-one |
| Synonym | Source |
|---|---|
| (5E)-4-hydroxy-3-(4-hydroxyphenyl)-5-[(4-hydroxyphenyl)methylidene]furan-2(5H)-one | IUPAC |
| Citations |
|---|