EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O6 |
| Net Charge | 0 |
| Average Mass | 304.298 |
| Monoisotopic Mass | 304.09469 |
| SMILES | COc1cc([C@H]2Oc3cc(O)cc(O)c3C[C@@H]2O)ccc1O |
| InChI | InChI=1S/C16H16O6/c1-21-15-4-8(2-3-11(15)18)16-13(20)7-10-12(19)5-9(17)6-14(10)22-16/h2-6,13,16-20H,7H2,1H3/t13-,16+/m0/s1 |
| InChIKey | NJHJXXLBWQXMRO-XJKSGUPXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Machilus wangchiana (ncbitaxon:460783) | root (BTO:0001188) | PubMed (25612442) | |
| Picea abies (ncbitaxon:3329) | bark (BTO:0001301) | PubMed (7669281) | Isolated from root bark. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-catechin-3'-methyl ether (CHEBI:149610) has functional parent (+)-catechin (CHEBI:15600) |
| (+)-catechin-3'-methyl ether (CHEBI:149610) has role plant metabolite (CHEBI:76924) |
| (+)-catechin-3'-methyl ether (CHEBI:149610) is a catechin (CHEBI:23053) |
| (+)-catechin-3'-methyl ether (CHEBI:149610) is a monomethoxybenzene (CHEBI:25235) |
| (+)-catechin-3'-methyl ether (CHEBI:149610) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2R,3S)-2-(4-hydroxy-3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| Synonyms | Source |
|---|---|
| (2R,3S)-2-(4-hydroxy-3-methoxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol | IUPAC |
| (2R-trans)-3,4-dihydro-2-(4-hydroxy-3-methoxyphenyl)-2H-1-benzopyran-3,5,7-triol | ChEBI |
| (+)-3'-O-methylcatechin | ChEBI |
| 3'-O-methyl-(+)-catechin | ChEBI |
| 3'-O-methylcatechin | HMDB |
| 3'-O-methylcyanidanol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB021479 | FooDB |
| HMDB0041507 | HMDB |
| LMPK12020142 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:60383-97-3 | ChEBI |
| Citations |
|---|