EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O6S |
| Net Charge | 0 |
| Average Mass | 246.240 |
| Monoisotopic Mass | 246.01981 |
| SMILES | O=C(O)CCc1ccc(OS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H10O6S/c10-9(11)6-3-7-1-4-8(5-2-7)15-16(12,13)14/h1-2,4-5H,3,6H2,(H,10,11)(H,12,13,14) |
| InChIKey | YKAVCSNFDHAGEG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood plasma (BTO_0000131) | DOI (10.1016/j.foodres.2014.05.009) | ||
| urine (BTO:0001419) | DOI (10.1016/j.foodres.2014.05.009) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[4-(sulfooxy)phenyl]propanoic acid (CHEBI:149609) has role human xenobiotic metabolite (CHEBI:76967) |
| 3-[4-(sulfooxy)phenyl]propanoic acid (CHEBI:149609) is a aryl sulfate (CHEBI:37919) |
| 3-[4-(sulfooxy)phenyl]propanoic acid (CHEBI:149609) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-[4-(sulfooxy)phenyl]propanoic acid |
| Synonym | Source |
|---|---|
| hydroxyphenylpropionic acid sulfate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0125171 | HMDB |
| Citations |
|---|