EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2O5 |
| Net Charge | 0 |
| Average Mass | 280.280 |
| Monoisotopic Mass | 280.10592 |
| SMILES | NC(=O)CC[C@@H](C(=O)O)N(O)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H16N2O5/c14-11(16)7-6-10(13(18)19)15(20)12(17)8-9-4-2-1-3-5-9/h1-5,10,20H,6-8H2,(H2,14,16)(H,18,19)/t10-/m0/s1 |
| InChIKey | PVRNBIBVLPANFY-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxyphenylacetylglutamine (CHEBI:149608) is a N2-acyl-L-glutamine (CHEBI:17008) |