EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H36O5 |
| Net Charge | 0 |
| Average Mass | 344.492 |
| Monoisotopic Mass | 344.25627 |
| SMILES | CC(C)(CCCCCC(O)CCCCCC(C)(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H36O5/c1-18(2,16(21)22)13-9-5-7-11-15(20)12-8-6-10-14-19(3,4)17(23)24/h15,20H,5-14H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | HYHMLYSLQUKXKP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 2.3.3.8 (ATP citrate synthase) inhibitor An EC 2.3.3.* (acyltransferase converting acyl to alkyl group on transfer) inhibitor that interferes with the action of ATP citrate synthase (EC 2.3.3.8). |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bempedoic acid (CHEBI:149601) has role antilipemic drug (CHEBI:35679) |
| bempedoic acid (CHEBI:149601) has role EC 2.3.3.8 (ATP citrate synthase) inhibitor (CHEBI:149598) |
| bempedoic acid (CHEBI:149601) has role prodrug (CHEBI:50266) |
| bempedoic acid (CHEBI:149601) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| IUPAC Name |
|---|
| 8-hydroxy-2,2,14,14-tetramethylpentadecanedioic acid |
| INNs | Source |
|---|---|
| bempedoic acid | WHO MedNet |
| acidum bempedoicum | WHO MedNet |
| acide bempédoïque | WHO MedNet |
| ácido bempedoico | WHO MedNet |
| Synonyms | Source |
|---|---|
| ETC1002 | ChemIDplus |
| ETC 1002 | ChemIDplus |
| ETC-1002 | ChemIDplus |
| ESP-55016 | ChemIDplus |
| ESP 55016 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Nexletol | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| Bempedoic_acid | Wikipedia |
| DB11936 | DrugBank |
| D10691 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:738606-46-7 | ChemIDplus |
| Citations |
|---|