EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32O12 |
| Net Charge | 0 |
| Average Mass | 524.519 |
| Monoisotopic Mass | 524.18938 |
| SMILES | [H][C@@]1(CC(=O)OCCc2ccc(O)cc2)C(C(=O)OC)=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)/C1=C/C |
| InChI | InChI=1S/C25H32O12/c1-3-15-16(10-19(28)34-9-8-13-4-6-14(27)7-5-13)17(23(32)33-2)12-35-24(15)37-25-22(31)21(30)20(29)18(11-26)36-25/h3-7,12,16,18,20-22,24-27,29-31H,8-11H2,1-2H3/b15-3+/t16-,18+,20+,21-,22+,24-,25-/m0/s1 |
| InChIKey | GMQXOLRKJQWPNB-MVVLSVRYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fraxinus angustifolia (ncbitaxon:166594) | leaf (BTO:0000713) | PubMed (32298276) | |
| Olea europaea (ncbitaxon:4146) | - | PubMed (31578603) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ligstroside (CHEBI:149585) has role antineoplastic agent (CHEBI:35610) |
| ligstroside (CHEBI:149585) has role plant metabolite (CHEBI:76924) |
| ligstroside (CHEBI:149585) is a diester (CHEBI:51307) |
| ligstroside (CHEBI:149585) is a methyl ester (CHEBI:25248) |
| ligstroside (CHEBI:149585) is a phenols (CHEBI:33853) |
| ligstroside (CHEBI:149585) is a pyrans (CHEBI:26407) |
| ligstroside (CHEBI:149585) is a secoiridoid glycoside (CHEBI:50274) |
| ligstroside (CHEBI:149585) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| methyl (2S,3E,4S)-3-ethylidene-2-(β-D-glucopyranosyloxy)-4-{2-[2-(4-hydroxyphenyl)ethoxy]-2-oxoethyl}-3,4-dihydro-2H-pyran-5-carboxylate |
| Synonyms | Source |
|---|---|
| (−)-ligstroside | KNApSAcK |
| ligusroside | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00010785 | KNApSAcK |
| CPD-20220 | MetaCyc |
| FDB013297 | FooDB |
| HMDB0034751 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:35897-92-8 | ChemIDplus |
| Citations |
|---|