EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17NO6S |
| Net Charge | 0 |
| Average Mass | 291.325 |
| Monoisotopic Mass | 291.07766 |
| SMILES | NC(CSC1CC(O)C=CC1(O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H17NO6S/c12-7(10(16)17)5-19-8-3-6(13)1-2-11(8,18)4-9(14)15/h1-2,6-8,13,18H,3-5,12H2,(H,14,15)(H,16,17) |
| InChIKey | SPXVLTDISXZSFM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (858207) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hawkinsin (CHEBI:149584) has role biomarker (CHEBI:59163) |
| hawkinsin (CHEBI:149584) has role human urinary metabolite (CHEBI:84087) |
| hawkinsin (CHEBI:149584) is a cycloalkene (CHEBI:33643) |
| hawkinsin (CHEBI:149584) is a cysteine derivative (CHEBI:23509) |
| hawkinsin (CHEBI:149584) is a dicarboxylic acid (CHEBI:35692) |
| hawkinsin (CHEBI:149584) is a diol (CHEBI:23824) |
| hawkinsin (CHEBI:149584) is a secondary allylic alcohol (CHEBI:134396) |
| hawkinsin (CHEBI:149584) is a tertiary allylic alcohol (CHEBI:134397) |
| IUPAC Name |
|---|
| S-[2-(carboxymethyl)-2,5-dihydroxycyclohex-3-en-1-yl]cysteine |
| Manual Xrefs | Databases |
|---|---|
| CPD66-101 | MetaCyc |
| FDB022975 | FooDB |
| Hawkinsin | Wikipedia |
| HMDB0002354 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:63224-90-8 | ChemIDplus |
| Citations |
|---|