EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17N2S |
| Net Charge | +1 |
| Average Mass | 221.349 |
| Monoisotopic Mass | 221.11070 |
| SMILES | Cc1cccc(C)c1NC1=[NH+]CCCS1 |
| InChI | InChI=1S/C12H16N2S/c1-9-5-3-6-10(2)11(9)14-12-13-7-4-8-15-12/h3,5-6H,4,7-8H2,1-2H3,(H,13,14)/p+1 |
| InChIKey | BPICBUSOMSTKRF-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xylazine(1+) (CHEBI:149565) is a organic cation (CHEBI:25697) |
| xylazine(1+) (CHEBI:149565) is conjugate acid of xylazine (CHEBI:92386) |
| Incoming Relation(s) |
| xylazine hydrochloride (CHEBI:149566) has part xylazine(1+) (CHEBI:149565) |
| xylazine (CHEBI:92386) is conjugate base of xylazine(1+) (CHEBI:149565) |
| IUPAC Name |
|---|
| 2-(2,6-dimethylanilino)-5,6-dihydro-4H-1,3-thiazin-3-ium |