EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H16N4O2 |
| Net Charge | 0 |
| Average Mass | 176.220 |
| Monoisotopic Mass | 176.12733 |
| SMILES | CC(C)N(CCCN)N(O)N=O |
| InChI | InChI=1S/C6H16N4O2/c1-6(2)9(5-3-4-7)10(12)8-11/h6,12H,3-5,7H2,1-2H3 |
| InChIKey | WEHZRCACNLQADC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | nitric oxide donor An agent, with unique chemical structure and biochemical requirements, which generates nitric oxide. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NOC-5 (CHEBI:149521) has role nitric oxide donor (CHEBI:50566) |
| NOC-5 (CHEBI:149521) is a nitroso compound (CHEBI:35800) |
| NOC-5 (CHEBI:149521) is a primary amino compound (CHEBI:50994) |
| NOC-5 (CHEBI:149521) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-(3-aminopropyl)-N-hydroxy-N-propan-2-ylnitrous hydrazide |
| Synonyms | Source |
|---|---|
| 1-hydroxy-2-oxo-3-(3-aminopropyl)-3-isopropyl-1-triazene | ChemIDplus |
| 3-(2-hydroxy-1-(1-methylethyl)-2-nitrosohydrazino)-1-propanamine | ChemIDplus |
| 3-[2-hydroxy-1-(1-methylethyl)-2-nitrosohydrazinyl]-1-propanamine | SUBMITTER |
| 3-(2-hydroxy-1-isopropyl-2-nitrosohydrazino)propane-1-amine | ChEBI |
| 3-(aminopropyl)-1-hydroxy-3-isopropyl-2-oxo-1-triazene | SUBMITTER |
| NOC 5 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:146724-82-5 | ChemIDplus |
| Citations |
|---|