EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H74N16O10 |
| Net Charge | 0 |
| Average Mass | 1059.244 |
| Monoisotopic Mass | 1058.57738 |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1cncn1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C50H74N16O10/c1-4-28(2)40(51)46(73)60-29(3)41(68)61-34(13-8-20-57-49(52)53)42(69)62-35(14-9-21-58-50(54)55)43(70)64-37(25-32-26-56-27-59-32)47(74)66-22-10-15-39(66)45(72)63-36(23-31-16-18-33(67)19-17-31)44(71)65-38(48(75)76)24-30-11-6-5-7-12-30/h5-7,11-12,16-19,26-29,34-40,67H,4,8-10,13-15,20-25,51H2,1-3H3,(H,56,59)(H,60,73)(H,61,68)(H,62,69)(H,63,72)(H,64,70)(H,65,71)(H,75,76)(H4,52,53,57)(H4,54,55,58)/t28-,29-,34-,35-,36-,37-,38-,39-,40-/m0/s1 |
| InChIKey | KLNGALQMFAURPH-NOQNJSOHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO_0000131) | PubMed (2474609) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | histamine releasing agent Any substance that can induce the release of histamine from mast cells. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kinetensin (1-8) (CHEBI:149501) has role histamine releasing agent (CHEBI:75298) |
| kinetensin (1-8) (CHEBI:149501) has role human metabolite (CHEBI:77746) |
| kinetensin (1-8) (CHEBI:149501) is a oligopeptide (CHEBI:25676) |
| kinetensin (1-8) (CHEBI:149501) is conjugate base of kinetensin (1-8)(2+) (CHEBI:147365) |
| Incoming Relation(s) |
| kinetensin (1-8)(2+) (CHEBI:147365) is conjugate acid of kinetensin (1-8) (CHEBI:149501) |
| IUPAC Name |
|---|
| L-isoleucyl-L-alanyl-L-arginyl-L-arginyl-L-histidyl-L-prolyl-L-tyrosyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| (des-Leu9)-kinetensin | ChEBI |
| H-Ile-Ala-Arg-Arg-His-Pro-Tyr-Phe-OH | ChEBI |
| histamine-releasing peptide | ChemIDplus |
| I-A-R-R-H-P-Y-F | ChEBI |
| IARRHPYF | ChEBI |
| Ile-Ala-Arg-Arg-His-Pro-Tyr-Phe | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB029232 | FooDB |
| HMDB0012985 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:123496-28-6 | ChemIDplus |
| Citations |
|---|