EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28ClN3 |
| Net Charge | +2 |
| Average Mass | 321.896 |
| Monoisotopic Mass | 321.19608 |
| SMILES | CC[NH+](CC)CCCC(C)Nc1cc[nH+]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21)/p+2 |
| InChIKey | WHTVZRBIWZFKQO-UHFFFAOYSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloroquine(2+) (CHEBI:149484) is a quinolinium ion (CHEBI:52837) |
| chloroquine(2+) (CHEBI:149484) is a tertiary ammonium ion (CHEBI:137982) |
| chloroquine(2+) (CHEBI:149484) is conjugate acid of chloroquine (CHEBI:3638) |
| Incoming Relation(s) |
| chloroquine (CHEBI:3638) is conjugate base of chloroquine(2+) (CHEBI:149484) |
| IUPAC Name |
|---|
| 7-chloro-4-{[5-(diethylazaniumyl)pentan-2-yl]amino}quinolinium |
| Synonyms | Source |
|---|---|
| di-protonated chloroquine | ChEBI |
| chloroquine dication | ChEBI |
| Citations |
|---|