EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31NO8 |
| Net Charge | 0 |
| Average Mass | 425.478 |
| Monoisotopic Mass | 425.20497 |
| SMILES | CNCC(c1ccc(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C21H31NO8/c1-22-11-14(21(28)9-3-2-4-10-21)12-5-7-13(8-6-12)29-20-17(25)15(23)16(24)18(30-20)19(26)27/h5-8,14-18,20,22-25,28H,2-4,9-11H2,1H3,(H,26,27)/t14?,15-,16-,17+,18-,20+/m0/s1 |
| InChIKey | UDNAJOOLWIWCAW-SQBZNDFJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:960) | urine (BTO:0001419) | PubMed (31659512) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,O-didesmethylvenlafaxine-glucuronide (CHEBI:149475) is a aralkylamine (CHEBI:18000) |
| N,O-didesmethylvenlafaxine-glucuronide (CHEBI:149475) is a cyclohexanols (CHEBI:23480) |
| N,O-didesmethylvenlafaxine-glucuronide (CHEBI:149475) is a glucosiduronic acid (CHEBI:24302) |
| N,O-didesmethylvenlafaxine-glucuronide (CHEBI:149475) is a glycoside (CHEBI:24400) |