EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O5 |
| Net Charge | 0 |
| Average Mass | 214.217 |
| Monoisotopic Mass | 214.08412 |
| SMILES | CC(=O)O[C@H]1[C@H](C)OC=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C10H14O5/c1-6-10(15-8(3)12)9(4-5-13-6)14-7(2)11/h4-6,9-10H,1-3H3/t6-,9-,10-/m0/s1 |
| InChIKey | NDEGMKQAZZBNBB-JUWDTYFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:960) | urine (BTO:0001419) | PubMed (31659512) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-di-O-acetyl-6-deoxy-L-glucal (CHEBI:149474) is a dicarboxylic acids and O-substituted derivatives (CHEBI:131927) |
| Synonym | Source |
|---|---|
| 3,4-di-O-acetyl-1,5-anhydro-2,6-dideoxy-L-arabino-hex-1-enitol | SUBMITTER |