EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N6O |
| Net Charge | 0 |
| Average Mass | 302.382 |
| Monoisotopic Mass | 302.18551 |
| SMILES | CC(C)CNc1nc(N)nc2c1ncn2[C@H]1C=C[C@@H](CO)C1 |
| InChI | InChI=1S/C15H22N6O/c1-9(2)6-17-13-12-14(20-15(16)19-13)21(8-18-12)11-4-3-10(5-11)7-22/h3-4,8-11,22H,5-7H2,1-2H3,(H3,16,17,19,20)/t10-,11+/m1/s1 |
| InChIKey | UHZARYILKCVWLR-MNOVXSKESA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-de(cyclopropylamino)-6-(isobutylamino)abacavir (CHEBI:149437) has functional parent abacavir (CHEBI:421707) |
| 6-de(cyclopropylamino)-6-(isobutylamino)abacavir (CHEBI:149437) has role antiviral agent (CHEBI:22587) |
| 6-de(cyclopropylamino)-6-(isobutylamino)abacavir (CHEBI:149437) is a 2,6-diaminopurines (CHEBI:38001) |
| IUPAC Name |
|---|
| [(1S,4R)-4-{2-amino-6-[(2-methylpropyl)amino]-9H-purin-9-yl}cyclopent-2-en-1-yl]methanol |
| Synonyms | Source |
|---|---|
| {(1S,4R)-4-[2-amino-6-(isobutylamino)-9H-purin-9-yl]cyclopent-2-en-1-yl}methanol | IUPAC |
| (1S,4R)-4-[2-amino-6-[(2-methylpropyl)amino]-9H-purin-9-yl]-2-cyclopentene-1-methanol | ChEBI |
| Citations |
|---|