EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21FN6O |
| Net Charge | 0 |
| Average Mass | 344.394 |
| Monoisotopic Mass | 344.17609 |
| SMILES | Nc1nc(N2CC(F)(C3CC3)C2)c2ncn([C@H]3C=C[C@@H](CO)C3)c2n1 |
| InChI | InChI=1S/C17H21FN6O/c18-17(11-2-3-11)7-23(8-17)14-13-15(22-16(19)21-14)24(9-20-13)12-4-1-10(5-12)6-25/h1,4,9-12,25H,2-3,5-8H2,(H2,19,21,22)/t10-,12+/m1/s1 |
| InChIKey | PVCSYQLWBAGPTF-PWSUYJOCSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. drug allergen Any drug which causes the onset of an allergic reaction. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-de(cyclopropylamino)-6-(3-cyclopropyl-3-fluoroazetidin-1-yl)abacavir (CHEBI:149436) has role antiviral agent (CHEBI:22587) |
| 6-de(cyclopropylamino)-6-(3-cyclopropyl-3-fluoroazetidin-1-yl)abacavir (CHEBI:149436) is a 2,6-diaminopurines (CHEBI:38001) |
| 6-de(cyclopropylamino)-6-(3-cyclopropyl-3-fluoroazetidin-1-yl)abacavir (CHEBI:149436) is a abacavir (CHEBI:421707) |
| IUPAC Name |
|---|
| {(1S,4R)-4-[2-amino-6-(3-cyclopropyl-3-fluoroazetidin-1-yl)-9H-purin-9-yl]cyclopent-2-en-1-yl}methanol |
| Synonym | Source |
|---|---|
| (1S,4R)-4-[2-amino-6-(3-cyclopropyl-3-fluoro-1-azetidinyl)-9H-purin-9-yl]-2-cyclopentene-1-methanol | ChEBI |
| Citations |
|---|